C30H37N7OS — CID 40780240
1-[[(2R,4S,5S)-5-[[(1R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-(4-pyrazol-1-ylphenyl)thiourea (PubChem CID 40780240) has the molecular formula C30H37N7OS and a molecular weight of 543.74 g/mol. Its IUPAC name is 1-[[(2R,4S,5S)-5-[[(1R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-(4-pyrazol-1-ylphenyl)thiourea.
| Compound Name | 1-[[(2R,4S,5S)-5-[[(1R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-(4-pyrazol-1-ylphenyl)thiourea |
|---|---|
| PubChem CID | 40780240 |
| Molecular Formula | C30H37N7OS |
| Molecular Weight | 543.74 g/mol |
| Exact Mass | 543.28 |
| IUPAC Name | 1-[[(2R,4S,5S)-5-[[(1R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-(4-pyrazol-1-ylphenyl)thiourea |
| SMILES | O=c1cccc2n1C[C@H]1C[C@@H]2CN(C[C@H]2CN3CC[C@H]2C[C@@H]3CNC(=S)Nc2ccc(-n3cccn3)cc2)C1 |
| InChI | InChI=1S/C30H37N7OS/c38-29-4-1-3-28-23-13-21(17-36(28)29)16-34(18-23)19-24-20-35-12-9-22(24)14-27(35)15-31-30(39)33-25-5-7-26(8-6-25)37-11-2-10-32-37/h1-8,10-11,21-24,27H,9,12-20H2,(H2,31,33,39)/t21-,22-,23+,24-,27+/m0/s1 |
| InChIKey | BRBWHFSOOANHIM-RTCYWULBSA-N |
| XLogP | 3.15 |
| TPSA | 70.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.74 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|