C17H32N4OS2 — CID 28991151
1-(2-methoxyethyl)-3-[[(2R,4S,5S)-5-(thiomorpholin-4-ylmethyl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiourea (PubChem CID 28991151) has the molecular formula C17H32N4OS2 and a molecular weight of 372.60 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-[[(2R,4S,5S)-5-(thiomorpholin-4-ylmethyl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiourea.
| Compound Name | 1-(2-methoxyethyl)-3-[[(2R,4S,5S)-5-(thiomorpholin-4-ylmethyl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 28991151 |
| Molecular Formula | C17H32N4OS2 |
| Molecular Weight | 372.60 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 1-(2-methoxyethyl)-3-[[(2R,4S,5S)-5-(thiomorpholin-4-ylmethyl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiourea |
| SMILES | COCCNC(=S)NC[C@H]1C[C@@H]2CCN1C[C@@H]2CN1CCSCC1 |
| InChI | InChI=1S/C17H32N4OS2/c1-22-7-3-18-17(23)19-11-16-10-14-2-4-21(16)13-15(14)12-20-5-8-24-9-6-20/h14-16H,2-13H2,1H3,(H2,18,19,23)/t14-,15-,16+/m0/s1 |
| InChIKey | DJDFICGTUUCDHP-HRCADAONSA-N |
| XLogP | 0.86 |
| TPSA | 39.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.60 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|