C19H36N4OS — CID 74451030
1-(2-methoxyethyl)-3-[[5-[(4-methylpiperidin-1-yl)methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiourea (PubChem CID 74451030) has the molecular formula C19H36N4OS and a molecular weight of 368.59 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-[[5-[(4-methylpiperidin-1-yl)methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiourea.
| Compound Name | 1-(2-methoxyethyl)-3-[[5-[(4-methylpiperidin-1-yl)methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 74451030 |
| Molecular Formula | C19H36N4OS |
| Molecular Weight | 368.59 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | 1-(2-methoxyethyl)-3-[[5-[(4-methylpiperidin-1-yl)methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiourea |
| SMILES | COCCNC(=S)NCC1CC2CCN1CC2CN1CCC(C)CC1 |
| InChI | InChI=1S/C19H36N4OS/c1-15-3-7-22(8-4-15)13-17-14-23-9-5-16(17)11-18(23)12-21-19(25)20-6-10-24-2/h15-18H,3-14H2,1-2H3,(H2,20,21,25) |
| InChIKey | UVPFCOOBQTVCAY-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 39.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.59 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|