C19H30N4OS2 — CID 163092860
1-(furan-2-ylmethyl)-3-[[(2S,4R,5S)-5-(thiomorpholin-4-ylmethyl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiourea (PubChem CID 163092860) has the molecular formula C19H30N4OS2 and a molecular weight of 394.61 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-[[(2S,4R,5S)-5-(thiomorpholin-4-ylmethyl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiourea.
| Compound Name | 1-(furan-2-ylmethyl)-3-[[(2S,4R,5S)-5-(thiomorpholin-4-ylmethyl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 163092860 |
| Molecular Formula | C19H30N4OS2 |
| Molecular Weight | 394.61 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-[[(2S,4R,5S)-5-(thiomorpholin-4-ylmethyl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiourea |
| SMILES | S=C(NCc1ccco1)NC[C@@H]1C[C@H]2CCN1C[C@@H]2CN1CCSCC1 |
| InChI | InChI=1S/C19H30N4OS2/c25-19(21-12-18-2-1-7-24-18)20-11-17-10-15-3-4-23(17)14-16(15)13-22-5-8-26-9-6-22/h1-2,7,15-17H,3-6,8-14H2,(H2,20,21,25)/t15-,16+,17+/m1/s1 |
| InChIKey | AIYATVHGDYKGOK-IKGGRYGDSA-N |
| XLogP | 2.00 |
| TPSA | 43.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.61 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|