C19H28N4OS — CID 74579673
1-(furan-2-ylmethyl)-3-[[5-[[methyl(prop-2-ynyl)amino]methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiourea (PubChem CID 74579673) has the molecular formula C19H28N4OS and a molecular weight of 360.53 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-[[5-[[methyl(prop-2-ynyl)amino]methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiourea.
| Compound Name | 1-(furan-2-ylmethyl)-3-[[5-[[methyl(prop-2-ynyl)amino]methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 74579673 |
| Molecular Formula | C19H28N4OS |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-[[5-[[methyl(prop-2-ynyl)amino]methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiourea |
| SMILES | C#CCN(C)CC1CN2CCC1CC2CNC(=S)NCc1ccco1 |
| InChI | InChI=1S/C19H28N4OS/c1-3-7-22(2)13-16-14-23-8-6-15(16)10-17(23)11-20-19(25)21-12-18-5-4-9-24-18/h1,4-5,9,15-17H,6-8,10-14H2,2H3,(H2,20,21,25) |
| InChIKey | DBQXAVFRPPNMLW-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 43.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|