C23H37N5OS — CID 74579632
1-[[5-[(N-methylanilino)methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-(2-morpholin-4-ylethyl)thiourea (PubChem CID 74579632) has the molecular formula C23H37N5OS and a molecular weight of 431.65 g/mol. Its IUPAC name is 1-[[5-[(N-methylanilino)methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 1-[[5-[(N-methylanilino)methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 74579632 |
| Molecular Formula | C23H37N5OS |
| Molecular Weight | 431.65 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | 1-[[5-[(N-methylanilino)methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-(2-morpholin-4-ylethyl)thiourea |
| SMILES | CN(CC1CN2CCC1CC2CNC(=S)NCCN1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C23H37N5OS/c1-26(21-5-3-2-4-6-21)17-20-18-28-9-7-19(20)15-22(28)16-25-23(30)24-8-10-27-11-13-29-14-12-27/h2-6,19-20,22H,7-18H2,1H3,(H2,24,25,30) |
| InChIKey | PPDLDTCUZKEDHU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 43.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.65 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|