C17H19N3O2S — CID 11943418
3-cyano-N-[[(2R,4S,5S)-5-ethynyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]benzenesulfonamide (PubChem CID 11943418) has the molecular formula C17H19N3O2S and a molecular weight of 329.43 g/mol. Its IUPAC name is 3-cyano-N-[[(2R,4S,5S)-5-ethynyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]benzenesulfonamide.
| Compound Name | 3-cyano-N-[[(2R,4S,5S)-5-ethynyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 11943418 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 3-cyano-N-[[(2R,4S,5S)-5-ethynyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]benzenesulfonamide |
| SMILES | C#C[C@H]1CN2CC[C@H]1C[C@@H]2CNS(=O)(=O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C17H19N3O2S/c1-2-14-12-20-7-6-15(14)9-16(20)11-19-23(21,22)17-5-3-4-13(8-17)10-18/h1,3-5,8,14-16,19H,6-7,9,11-12H2/t14-,15-,16+/m0/s1 |
| InChIKey | YSRCEFDPRAXWRC-HRCADAONSA-N |
| XLogP | 1.18 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|