C17H23NO2S — CID 15907589
(2R,4S,5R)-5-ethenyl-2-[(4-methylphenyl)sulfonylmethyl]-1-azabicyclo[2.2.2]octane (PubChem CID 15907589) has the molecular formula C17H23NO2S and a molecular weight of 305.44 g/mol. Its IUPAC name is (2R,4S,5R)-5-ethenyl-2-[(4-methylphenyl)sulfonylmethyl]-1-azabicyclo[2.2.2]octane.
| Compound Name | (2R,4S,5R)-5-ethenyl-2-[(4-methylphenyl)sulfonylmethyl]-1-azabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 15907589 |
| Molecular Formula | C17H23NO2S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (2R,4S,5R)-5-ethenyl-2-[(4-methylphenyl)sulfonylmethyl]-1-azabicyclo[2.2.2]octane |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@@H]2CS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H23NO2S/c1-3-14-11-18-9-8-15(14)10-16(18)12-21(19,20)17-6-4-13(2)5-7-17/h3-7,14-16H,1,8-12H2,2H3/t14-,15-,16+/m0/s1 |
| InChIKey | NDVUJWUDXNZWDY-HRCADAONSA-N |
| XLogP | 2.67 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|