C14H18O4 — CID 159077258
2-hydroxy-3,9,11-trimethyl-1,5-dioxaspiro[5.7]trideca-2,7,12-trien-4-one (PubChem CID 159077258) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is 2-hydroxy-3,9,11-trimethyl-1,5-dioxaspiro[5.7]trideca-2,7,12-trien-4-one.
| Compound Name | 2-hydroxy-3,9,11-trimethyl-1,5-dioxaspiro[5.7]trideca-2,7,12-trien-4-one |
|---|---|
| PubChem CID | 159077258 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 2-hydroxy-3,9,11-trimethyl-1,5-dioxaspiro[5.7]trideca-2,7,12-trien-4-one |
| SMILES | CC1=C(O)OC2(C=CC(C)CC(C)C=C2)OC1=O |
| InChI | InChI=1S/C14H18O4/c1-9-4-6-14(7-5-10(2)8-9)17-12(15)11(3)13(16)18-14/h4-7,9-10,15H,8H2,1-3H3 |
| InChIKey | KAKGEQATHLHSNA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|