C43H25F2N9O3 — CID 159080391
2-(2,2-difluoro-1,3-benzodioxol-5-yl)-1H-imidazo[4,5-f][1,10]phenanthroline;3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-6-methyl-1H-quinolin-2-one (PubChem CID 159080391) has the molecular formula C43H25F2N9O3 and a molecular weight of 753.73 g/mol. Its IUPAC name is 2-(2,2-difluoro-1,3-benzodioxol-5-yl)-1H-imidazo[4,5-f][1,10]phenanthroline;3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-6-methyl-1H-quinolin-2-one.
| Compound Name | 2-(2,2-difluoro-1,3-benzodioxol-5-yl)-1H-imidazo[4,5-f][1,10]phenanthroline;3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-6-methyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 159080391 |
| Molecular Formula | C43H25F2N9O3 |
| Molecular Weight | 753.73 g/mol |
| Exact Mass | 753.20 |
| IUPAC Name | 2-(2,2-difluoro-1,3-benzodioxol-5-yl)-1H-imidazo[4,5-f][1,10]phenanthroline;3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-6-methyl-1H-quinolin-2-one |
| SMILES | Cc1ccc2[nH]c(=O)c(-c3nc4c5cccnc5c5ncccc5c4[nH]3)cc2c1.FC1(F)Oc2ccc(-c3nc4c5cccnc5c5ncccc5c4[nH]3)cc2O1 |
| InChI | InChI=1S/C23H15N5O.C20H10F2N4O2/c1-12-6-7-17-13(10-12)11-16(23(29)26-17)22-27-20-14-4-2-8-24-18(14)19-15(21(20)28-22)5-3-9-25-19;21-20(22)27-13-6-5-10(9-14(13)28-20)19-25-17-11-3-1-7-23-15(11)16-12(18(17)26-19)4-2-8-24-16/h2-11H,1H3,(H,26,29)(H,27,28);1-9H,(H,25,26) |
| InChIKey | KATZPBGBUSVONO-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 160.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.73 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|