C18H32N4O2 — CID 159080791
3-(aminomethyl)-N-[2-[5-(2-hydroxyethylamino)pentylamino]ethyl]-N-methylbenzamide (PubChem CID 159080791) has the molecular formula C18H32N4O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is 3-(aminomethyl)-N-[2-[5-(2-hydroxyethylamino)pentylamino]ethyl]-N-methylbenzamide.
| Compound Name | 3-(aminomethyl)-N-[2-[5-(2-hydroxyethylamino)pentylamino]ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 159080791 |
| Molecular Formula | C18H32N4O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | 3-(aminomethyl)-N-[2-[5-(2-hydroxyethylamino)pentylamino]ethyl]-N-methylbenzamide |
| SMILES | CN(CCNCCCCCNCCO)C(=O)c1cccc(CN)c1 |
| InChI | InChI=1S/C18H32N4O2/c1-22(18(24)17-7-5-6-16(14-17)15-19)12-10-20-8-3-2-4-9-21-11-13-23/h5-7,14,20-21,23H,2-4,8-13,15,19H2,1H3 |
| InChIKey | ZERWGFFWVPRYHF-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 90.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|