C21H30N4O — CID 167839561
3-[3-(aminomethyl)phenyl]-N-[3-[3-aminopropyl(methyl)amino]propyl]benzamide (PubChem CID 167839561) has the molecular formula C21H30N4O and a molecular weight of 354.50 g/mol. Its IUPAC name is 3-[3-(aminomethyl)phenyl]-N-[3-[3-aminopropyl(methyl)amino]propyl]benzamide.
| Compound Name | 3-[3-(aminomethyl)phenyl]-N-[3-[3-aminopropyl(methyl)amino]propyl]benzamide |
|---|---|
| PubChem CID | 167839561 |
| Molecular Formula | C21H30N4O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 3-[3-(aminomethyl)phenyl]-N-[3-[3-aminopropyl(methyl)amino]propyl]benzamide |
| SMILES | CN(CCCN)CCCNC(=O)c1cccc(-c2cccc(CN)c2)c1 |
| InChI | InChI=1S/C21H30N4O/c1-25(12-4-10-22)13-5-11-24-21(26)20-9-3-8-19(15-20)18-7-2-6-17(14-18)16-23/h2-3,6-9,14-15H,4-5,10-13,16,22-23H2,1H3,(H,24,26) |
| InChIKey | YWRSWCQPKLYJGR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|