C26H30O3S — CID 159081075
methyl 2-[[4-(4-ethyl-3,5-dimethylphenyl)-2,6-dimethylphenyl]methyl]benzenesulfonate (PubChem CID 159081075) has the molecular formula C26H30O3S and a molecular weight of 422.59 g/mol. Its IUPAC name is methyl 2-[[4-(4-ethyl-3,5-dimethylphenyl)-2,6-dimethylphenyl]methyl]benzenesulfonate.
| Compound Name | methyl 2-[[4-(4-ethyl-3,5-dimethylphenyl)-2,6-dimethylphenyl]methyl]benzenesulfonate |
|---|---|
| PubChem CID | 159081075 |
| Molecular Formula | C26H30O3S |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | methyl 2-[[4-(4-ethyl-3,5-dimethylphenyl)-2,6-dimethylphenyl]methyl]benzenesulfonate |
| SMILES | CCc1c(C)cc(-c2cc(C)c(Cc3ccccc3S(=O)(=O)OC)c(C)c2)cc1C |
| InChI | InChI=1S/C26H30O3S/c1-7-24-17(2)12-22(13-18(24)3)23-14-19(4)25(20(5)15-23)16-21-10-8-9-11-26(21)30(27,28)29-6/h8-15H,7,16H2,1-6H3 |
| InChIKey | JBFLXWJVJQANCE-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|