C28H29Br3N6O2 — CID 159081662
1-bromo-2,2-dimethoxypropane;6-bromo-2-methyl-8-phenylimidazo[1,2-a]pyrazine;5-bromo-3-phenylpyrazin-2-amine (PubChem CID 159081662) has the molecular formula C28H29Br3N6O2 and a molecular weight of 721.29 g/mol. Its IUPAC name is 1-bromo-2,2-dimethoxypropane;6-bromo-2-methyl-8-phenylimidazo[1,2-a]pyrazine;5-bromo-3-phenylpyrazin-2-amine.
| Compound Name | 1-bromo-2,2-dimethoxypropane;6-bromo-2-methyl-8-phenylimidazo[1,2-a]pyrazine;5-bromo-3-phenylpyrazin-2-amine |
|---|---|
| PubChem CID | 159081662 |
| Molecular Formula | C28H29Br3N6O2 |
| Molecular Weight | 721.29 g/mol |
| Exact Mass | 717.99 |
| IUPAC Name | 1-bromo-2,2-dimethoxypropane;6-bromo-2-methyl-8-phenylimidazo[1,2-a]pyrazine;5-bromo-3-phenylpyrazin-2-amine |
| SMILES | COC(C)(CBr)OC.Cc1cn2cc(Br)nc(-c3ccccc3)c2n1.Nc1ncc(Br)nc1-c1ccccc1 |
| InChI | InChI=1S/C13H10BrN3.C10H8BrN3.C5H11BrO2/c1-9-7-17-8-11(14)16-12(13(17)15-9)10-5-3-2-4-6-10;11-8-6-13-10(12)9(14-8)7-4-2-1-3-5-7;1-5(4-6,7-2)8-3/h2-8H,1H3;1-6H,(H2,12,13);4H2,1-3H3 |
| InChIKey | KAXYXBMJFWOGRP-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.29 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|