C16H16ClN2O+ — CID 159081774
2-[(2-chloro-1-methylpyridin-1-ium-4-yl)methylidene]-3,5-dimethyl-1,3-benzoxazole (PubChem CID 159081774) has the molecular formula C16H16ClN2O+ and a molecular weight of 287.77 g/mol. Its IUPAC name is 2-[(2-chloro-1-methylpyridin-1-ium-4-yl)methylidene]-3,5-dimethyl-1,3-benzoxazole.
| Compound Name | 2-[(2-chloro-1-methylpyridin-1-ium-4-yl)methylidene]-3,5-dimethyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 159081774 |
| Molecular Formula | C16H16ClN2O+ |
| Molecular Weight | 287.77 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2-[(2-chloro-1-methylpyridin-1-ium-4-yl)methylidene]-3,5-dimethyl-1,3-benzoxazole |
| SMILES | Cc1ccc2c(c1)N(C)C(=Cc1cc[n+](C)c(Cl)c1)O2 |
| InChI | InChI=1S/C16H16ClN2O/c1-11-4-5-14-13(8-11)19(3)16(20-14)10-12-6-7-18(2)15(17)9-12/h4-10H,1-3H3/q+1 |
| InChIKey | ZKXPDYBMGGDPJH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.77 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|