About CID 159082737
CID 159082737 (PubChem CID 159082737) has the molecular formula C24H17BBrCl2O2
and a molecular weight of 499.02 g/mol.
Molecular Properties
| Compound Name | CID 159082737 |
| PubChem CID | 159082737 |
| Molecular Formula | C24H17BBrCl2O2 |
| Molecular Weight | 499.02 g/mol |
| Exact Mass | 496.99 |
| IUPAC Name | — |
| SMILES | Clc1ccc(-c2ccccc2Br)cc1.O[B]Oc1ccccc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H9BClO2.C12H8BrCl/c14-10-7-5-9(6-8-10)11-3-1-2-4-12(11)16-13-15;13-12-4-2-1-3-11(12)9-5-7-10(14)8-6-9/h1-8,15H;1-8H |
| InChIKey | HJOGAPRZQYIKDU-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 499.02 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 159082737 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159082737?
The IUPAC name of CID 159082737 (CID 159082737) is not available.
What is the SMILES notation for CID 159082737?
The canonical SMILES for CID 159082737 is Clc1ccc(-c2ccccc2Br)cc1.O[B]Oc1ccccc1-c1ccc(Cl)cc1.
What is the InChIKey of CID 159082737?
The InChIKey is HJOGAPRZQYIKDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9BClO2.C12H8BrCl/c14-10-7-5-9(6-8-10)11-3-1-2-4-12(11)16-13-15;13-12-4-2-1-3-11(12)9-5-7-10(14)8-6-9/h1-8,15H;1-8H.
What are the key properties of CID 159082737?
CID 159082737 has a molecular weight of 499.02 g/mol, XLogP of 7.68, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159082737 is sourced from PubChem (CID 159082737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).