C10H26ClN3 — CID 159083467
N'-(3-aminopropyl)-N'-methylpropane-1,3-diamine;1-chloropropane (PubChem CID 159083467) has the molecular formula C10H26ClN3 and a molecular weight of 223.79 g/mol. Its IUPAC name is N'-(3-aminopropyl)-N'-methylpropane-1,3-diamine;1-chloropropane.
| Compound Name | N'-(3-aminopropyl)-N'-methylpropane-1,3-diamine;1-chloropropane |
|---|---|
| PubChem CID | 159083467 |
| Molecular Formula | C10H26ClN3 |
| Molecular Weight | 223.79 g/mol |
| Exact Mass | 223.18 |
| IUPAC Name | N'-(3-aminopropyl)-N'-methylpropane-1,3-diamine;1-chloropropane |
| SMILES | CCCCl.CN(CCCN)CCCN |
| InChI | InChI=1S/C7H19N3.C3H7Cl/c1-10(6-2-4-8)7-3-5-9;1-2-3-4/h2-9H2,1H3;2-3H2,1H3 |
| InChIKey | KBDMWAVTQNOQLX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.79 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|