About 7-(difluoromethoxy)chromen-4-one;7-hydroxychromen-4-one
7-(difluoromethoxy)chromen-4-one;7-hydroxychromen-4-one (PubChem CID 159090202) has the molecular formula C19H12F2O6
and a molecular weight of 374.30 g/mol. Its IUPAC name is 7-(difluoromethoxy)chromen-4-one;7-hydroxychromen-4-one.
Molecular Properties
| Compound Name | 7-(difluoromethoxy)chromen-4-one;7-hydroxychromen-4-one |
| PubChem CID | 159090202 |
| Molecular Formula | C19H12F2O6 |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 7-(difluoromethoxy)chromen-4-one;7-hydroxychromen-4-one |
| SMILES | O=c1ccoc2cc(O)ccc12.O=c1ccoc2cc(OC(F)F)ccc12 |
| InChI | InChI=1S/C10H6F2O3.C9H6O3/c11-10(12)15-6-1-2-7-8(13)3-4-14-9(7)5-6;10-6-1-2-7-8(11)3-4-12-9(7)5-6/h1-5,10H;1-5,10H |
| InChIKey | KBYSEBVQJUPXKX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-(difluoromethoxy)chromen-4-one;7-hydroxychromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(difluoromethoxy)chromen-4-one;7-hydroxychromen-4-one?
The IUPAC name of 7-(difluoromethoxy)chromen-4-one;7-hydroxychromen-4-one (CID 159090202) is 7-(difluoromethoxy)chromen-4-one;7-hydroxychromen-4-one.
What is the SMILES notation for 7-(difluoromethoxy)chromen-4-one;7-hydroxychromen-4-one?
The canonical SMILES for 7-(difluoromethoxy)chromen-4-one;7-hydroxychromen-4-one is O=c1ccoc2cc(O)ccc12.O=c1ccoc2cc(OC(F)F)ccc12.
What is the InChIKey of 7-(difluoromethoxy)chromen-4-one;7-hydroxychromen-4-one?
The InChIKey is KBYSEBVQJUPXKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6F2O3.C9H6O3/c11-10(12)15-6-1-2-7-8(13)3-4-14-9(7)5-6;10-6-1-2-7-8(11)3-4-12-9(7)5-6/h1-5,10H;1-5,10H.
What are the key properties of 7-(difluoromethoxy)chromen-4-one;7-hydroxychromen-4-one?
7-(difluoromethoxy)chromen-4-one;7-hydroxychromen-4-one has a molecular weight of 374.30 g/mol, XLogP of 3.89, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(difluoromethoxy)chromen-4-one;7-hydroxychromen-4-one is sourced from PubChem (CID 159090202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).