About 7-methoxychromen-4-one;nonane
7-methoxychromen-4-one;nonane (PubChem CID 175037162) has the molecular formula C19H28O3
and a molecular weight of 304.43 g/mol. Its IUPAC name is 7-methoxychromen-4-one;nonane.
Molecular Properties
| Compound Name | 7-methoxychromen-4-one;nonane |
| PubChem CID | 175037162 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 7-methoxychromen-4-one;nonane |
| SMILES | CCCCCCCCC.COc1ccc2c(=O)ccoc2c1 |
| InChI | InChI=1S/C10H8O3.C9H20/c1-12-7-2-3-8-9(11)4-5-13-10(8)6-7;1-3-5-7-9-8-6-4-2/h2-6H,1H3;3-9H2,1-2H3 |
| InChIKey | TZKAYDFXWZUHSP-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-methoxychromen-4-one;nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxychromen-4-one;nonane?
The IUPAC name of 7-methoxychromen-4-one;nonane (CID 175037162) is 7-methoxychromen-4-one;nonane.
What is the SMILES notation for 7-methoxychromen-4-one;nonane?
The canonical SMILES for 7-methoxychromen-4-one;nonane is CCCCCCCCC.COc1ccc2c(=O)ccoc2c1.
What is the InChIKey of 7-methoxychromen-4-one;nonane?
The InChIKey is TZKAYDFXWZUHSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O3.C9H20/c1-12-7-2-3-8-9(11)4-5-13-10(8)6-7;1-3-5-7-9-8-6-4-2/h2-6H,1H3;3-9H2,1-2H3.
What are the key properties of 7-methoxychromen-4-one;nonane?
7-methoxychromen-4-one;nonane has a molecular weight of 304.43 g/mol, XLogP of 5.56, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxychromen-4-one;nonane is sourced from PubChem (CID 175037162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).