About 7-decylchromen-4-one
7-decylchromen-4-one (PubChem CID 143676648) has the molecular formula C19H26O2
and a molecular weight of 286.42 g/mol. Its IUPAC name is 7-decylchromen-4-one.
Molecular Properties
| Compound Name | 7-decylchromen-4-one |
| PubChem CID | 143676648 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 7-decylchromen-4-one |
| SMILES | CCCCCCCCCCc1ccc2c(=O)ccoc2c1 |
| InChI | InChI=1S/C19H26O2/c1-2-3-4-5-6-7-8-9-10-16-11-12-17-18(20)13-14-21-19(17)15-16/h11-15H,2-10H2,1H3 |
| InChIKey | CUWZNRDMPRIJAI-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-decylchromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-decylchromen-4-one?
The IUPAC name of 7-decylchromen-4-one (CID 143676648) is 7-decylchromen-4-one.
What is the SMILES notation for 7-decylchromen-4-one?
The canonical SMILES for 7-decylchromen-4-one is CCCCCCCCCCc1ccc2c(=O)ccoc2c1.
What is the InChIKey of 7-decylchromen-4-one?
The InChIKey is CUWZNRDMPRIJAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26O2/c1-2-3-4-5-6-7-8-9-10-16-11-12-17-18(20)13-14-21-19(17)15-16/h11-15H,2-10H2,1H3.
What are the key properties of 7-decylchromen-4-one?
7-decylchromen-4-one has a molecular weight of 286.42 g/mol, XLogP of 5.48, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-decylchromen-4-one is sourced from PubChem (CID 143676648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).