C22H30N4O8 — CID 159090492
2-N-(1,3-dioxolan-2-ylmethyl)-4-methoxybenzene-1,2-diamine;N-(1,3-dioxolan-2-ylmethyl)-5-methoxy-2-nitroaniline (PubChem CID 159090492) has the molecular formula C22H30N4O8 and a molecular weight of 478.50 g/mol. Its IUPAC name is 2-N-(1,3-dioxolan-2-ylmethyl)-4-methoxybenzene-1,2-diamine;N-(1,3-dioxolan-2-ylmethyl)-5-methoxy-2-nitroaniline.
| Compound Name | 2-N-(1,3-dioxolan-2-ylmethyl)-4-methoxybenzene-1,2-diamine;N-(1,3-dioxolan-2-ylmethyl)-5-methoxy-2-nitroaniline |
|---|---|
| PubChem CID | 159090492 |
| Molecular Formula | C22H30N4O8 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | 2-N-(1,3-dioxolan-2-ylmethyl)-4-methoxybenzene-1,2-diamine;N-(1,3-dioxolan-2-ylmethyl)-5-methoxy-2-nitroaniline |
| SMILES | COc1ccc(N)c(NCC2OCCO2)c1.COc1ccc([N+](=O)[O-])c(NCC2OCCO2)c1 |
| InChI | InChI=1S/C11H14N2O5.C11H16N2O3/c1-16-8-2-3-10(13(14)15)9(6-8)12-7-11-17-4-5-18-11;1-14-8-2-3-9(12)10(6-8)13-7-11-15-4-5-16-11/h2-3,6,11-12H,4-5,7H2,1H3;2-3,6,11,13H,4-5,7,12H2,1H3 |
| InChIKey | KBZRDMDYUPZOMQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 148.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|