C36H28N6O8S2 — CID 159090673
ethyl 6-(4-aminophenoxy)imidazo[2,1-b][1,3]benzothiazole-1-carboxylate;ethyl 6-(4-nitrophenoxy)imidazo[2,1-b][1,3]benzothiazole-1-carboxylate (PubChem CID 159090673) has the molecular formula C36H28N6O8S2 and a molecular weight of 736.79 g/mol. Its IUPAC name is ethyl 6-(4-aminophenoxy)imidazo[2,1-b][1,3]benzothiazole-1-carboxylate;ethyl 6-(4-nitrophenoxy)imidazo[2,1-b][1,3]benzothiazole-1-carboxylate.
| Compound Name | ethyl 6-(4-aminophenoxy)imidazo[2,1-b][1,3]benzothiazole-1-carboxylate;ethyl 6-(4-nitrophenoxy)imidazo[2,1-b][1,3]benzothiazole-1-carboxylate |
|---|---|
| PubChem CID | 159090673 |
| Molecular Formula | C36H28N6O8S2 |
| Molecular Weight | 736.79 g/mol |
| Exact Mass | 736.14 |
| IUPAC Name | ethyl 6-(4-aminophenoxy)imidazo[2,1-b][1,3]benzothiazole-1-carboxylate;ethyl 6-(4-nitrophenoxy)imidazo[2,1-b][1,3]benzothiazole-1-carboxylate |
| SMILES | CCOC(=O)c1cnc2sc3cc(Oc4ccc(N)cc4)ccc3n12.CCOC(=O)c1cnc2sc3cc(Oc4ccc([N+](=O)[O-])cc4)ccc3n12 |
| InChI | InChI=1S/C18H13N3O5S.C18H15N3O3S/c1-2-25-17(22)15-10-19-18-20(15)14-8-7-13(9-16(14)27-18)26-12-5-3-11(4-6-12)21(23)24;1-2-23-17(22)15-10-20-18-21(15)14-8-7-13(9-16(14)25-18)24-12-5-3-11(19)4-6-12/h3-10H,2H2,1H3;3-10H,2,19H2,1H3 |
| InChIKey | KCAFONJLWLGGMK-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 174.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.79 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|