C18H13N3O4S2 — CID 118395715
ethyl 6-(4-nitrophenyl)sulfanylimidazo[2,1-b][1,3]benzothiazole-1-carboxylate (PubChem CID 118395715) has the molecular formula C18H13N3O4S2 and a molecular weight of 399.45 g/mol. Its IUPAC name is ethyl 6-(4-nitrophenyl)sulfanylimidazo[2,1-b][1,3]benzothiazole-1-carboxylate.
| Compound Name | ethyl 6-(4-nitrophenyl)sulfanylimidazo[2,1-b][1,3]benzothiazole-1-carboxylate |
|---|---|
| PubChem CID | 118395715 |
| Molecular Formula | C18H13N3O4S2 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | ethyl 6-(4-nitrophenyl)sulfanylimidazo[2,1-b][1,3]benzothiazole-1-carboxylate |
| SMILES | CCOC(=O)c1cnc2sc3cc(Sc4ccc([N+](=O)[O-])cc4)ccc3n12 |
| InChI | InChI=1S/C18H13N3O4S2/c1-2-25-17(22)15-10-19-18-20(15)14-8-7-13(9-16(14)27-18)26-12-5-3-11(4-6-12)21(23)24/h3-10H,2H2,1H3 |
| InChIKey | PMCBOYXSWVLAKS-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|