C13H12N2O5S — CID 134095645
ethyl 3-methyl-5-(4-nitrophenyl)sulfanyl-1,2-oxazole-4-carboxylate (PubChem CID 134095645) has the molecular formula C13H12N2O5S and a molecular weight of 308.32 g/mol. Its IUPAC name is ethyl 3-methyl-5-(4-nitrophenyl)sulfanyl-1,2-oxazole-4-carboxylate.
| Compound Name | ethyl 3-methyl-5-(4-nitrophenyl)sulfanyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 134095645 |
| Molecular Formula | C13H12N2O5S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | ethyl 3-methyl-5-(4-nitrophenyl)sulfanyl-1,2-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(C)noc1Sc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H12N2O5S/c1-3-19-12(16)11-8(2)14-20-13(11)21-10-6-4-9(5-7-10)15(17)18/h4-7H,3H2,1-2H3 |
| InChIKey | QXNFPRYCKGNOFB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 95.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|