C24H27F3N2O2S2 — CID 159091402
7-methoxy-1-[7-methyl-3-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]heptan-2-one (PubChem CID 159091402) has the molecular formula C24H27F3N2O2S2 and a molecular weight of 496.62 g/mol. Its IUPAC name is 7-methoxy-1-[7-methyl-3-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]heptan-2-one.
| Compound Name | 7-methoxy-1-[7-methyl-3-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]heptan-2-one |
|---|---|
| PubChem CID | 159091402 |
| Molecular Formula | C24H27F3N2O2S2 |
| Molecular Weight | 496.62 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 7-methoxy-1-[7-methyl-3-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]heptan-2-one |
| SMILES | COCCCCCC(=O)Cc1sc2c(c1-c1nc3cc(C(F)(F)F)ccc3s1)CCNC2C |
| InChI | InChI=1S/C24H27F3N2O2S2/c1-14-22-17(9-10-28-14)21(20(32-22)13-16(30)6-4-3-5-11-31-2)23-29-18-12-15(24(25,26)27)7-8-19(18)33-23/h7-8,12,14,28H,3-6,9-11,13H2,1-2H3 |
| InChIKey | GCCWAWOQQJIBBW-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.62 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|