C21H25N7O6 — CID 159094650
ethyl 2-formyl-3-oxopropanoate;ethyl 1-pyridin-4-ylpyrazole-4-carboxylate;pyridazin-4-ylhydrazine (PubChem CID 159094650) has the molecular formula C21H25N7O6 and a molecular weight of 471.47 g/mol. Its IUPAC name is ethyl 2-formyl-3-oxopropanoate;ethyl 1-pyridin-4-ylpyrazole-4-carboxylate;pyridazin-4-ylhydrazine.
| Compound Name | ethyl 2-formyl-3-oxopropanoate;ethyl 1-pyridin-4-ylpyrazole-4-carboxylate;pyridazin-4-ylhydrazine |
|---|---|
| PubChem CID | 159094650 |
| Molecular Formula | C21H25N7O6 |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | ethyl 2-formyl-3-oxopropanoate;ethyl 1-pyridin-4-ylpyrazole-4-carboxylate;pyridazin-4-ylhydrazine |
| SMILES | CCOC(=O)C(C=O)C=O.CCOC(=O)c1cnn(-c2ccncc2)c1.NNc1ccnnc1 |
| InChI | InChI=1S/C11H11N3O2.C6H8O4.C4H6N4/c1-2-16-11(15)9-7-13-14(8-9)10-3-5-12-6-4-10;1-2-10-6(9)5(3-7)4-8;5-8-4-1-2-6-7-3-4/h3-8H,2H2,1H3;3-5H,2H2,1H3;1-3H,5H2,(H,6,8) |
| InChIKey | KCMYAVXRCXIXOZ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 181.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|