C25H27NO3 — CID 159096013
3-[2,3,4,6-tetradeuterio-5-[3-[[(2R)-1,1-dideuterio-2-hydroxy-2-(2,3,4,6-tetradeuterio-5-methylphenyl)ethyl]amino]propyl]phenyl]benzoic acid (PubChem CID 159096013) has the molecular formula C25H27NO3 and a molecular weight of 399.56 g/mol. Its IUPAC name is 3-[2,3,4,6-tetradeuterio-5-[3-[[(2R)-1,1-dideuterio-2-hydroxy-2-(2,3,4,6-tetradeuterio-5-methylphenyl)ethyl]amino]propyl]phenyl]benzoic acid.
| Compound Name | 3-[2,3,4,6-tetradeuterio-5-[3-[[(2R)-1,1-dideuterio-2-hydroxy-2-(2,3,4,6-tetradeuterio-5-methylphenyl)ethyl]amino]propyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 159096013 |
| Molecular Formula | C25H27NO3 |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | 3-[2,3,4,6-tetradeuterio-5-[3-[[(2R)-1,1-dideuterio-2-hydroxy-2-(2,3,4,6-tetradeuterio-5-methylphenyl)ethyl]amino]propyl]phenyl]benzoic acid |
| SMILES | [2H]c1c([2H])c(CCCNC([2H])([2H])[C@H](O)c2c([2H])c([2H])c([2H])c(C)c2[2H])c([2H])c(-c2cccc(C(=O)O)c2)c1[2H] |
| InChI | InChI=1S/C25H27NO3/c1-18-6-2-11-22(14-18)24(27)17-26-13-5-8-19-7-3-9-20(15-19)21-10-4-12-23(16-21)25(28)29/h2-4,6-7,9-12,14-16,24,26-27H,5,8,13,17H2,1H3,(H,28,29)/t24-/m0/s1/i2D,3D,6D,7D,9D,11D,14D,15D,17D2 |
| InChIKey | QYYIBGLFVVXTII-SIBDIYMESA-N |
| XLogP | 4.62 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|