C25H27NO3 — CID 159127816
3-[3-[3,3-dideuterio-3-[[(2R)-2-deuterio-2-hydroxy-2-(2,3,4,6-tetradeuterio-5-methylphenyl)ethyl]amino]propyl]phenyl]benzoic acid (PubChem CID 159127816) has the molecular formula C25H27NO3 and a molecular weight of 396.54 g/mol. Its IUPAC name is 3-[3-[3,3-dideuterio-3-[[(2R)-2-deuterio-2-hydroxy-2-(2,3,4,6-tetradeuterio-5-methylphenyl)ethyl]amino]propyl]phenyl]benzoic acid.
| Compound Name | 3-[3-[3,3-dideuterio-3-[[(2R)-2-deuterio-2-hydroxy-2-(2,3,4,6-tetradeuterio-5-methylphenyl)ethyl]amino]propyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 159127816 |
| Molecular Formula | C25H27NO3 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | 3-[3-[3,3-dideuterio-3-[[(2R)-2-deuterio-2-hydroxy-2-(2,3,4,6-tetradeuterio-5-methylphenyl)ethyl]amino]propyl]phenyl]benzoic acid |
| SMILES | [2H]c1c([2H])c(C)c([2H])c([C@]([2H])(O)CNC([2H])([2H])CCc2cccc(-c3cccc(C(=O)O)c3)c2)c1[2H] |
| InChI | InChI=1S/C25H27NO3/c1-18-6-2-11-22(14-18)24(27)17-26-13-5-8-19-7-3-9-20(15-19)21-10-4-12-23(16-21)25(28)29/h2-4,6-7,9-12,14-16,24,26-27H,5,8,13,17H2,1H3,(H,28,29)/t24-/m1/s1/i2D,6D,11D,13D2,14D,24D |
| InChIKey | QYYIBGLFVVXTII-PHISMPRDSA-N |
| XLogP | 4.62 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |