C9H16N2 — CID 159097161
methane;N,1,4-trimethylpyridin-2-imine (PubChem CID 159097161) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is methane;N,1,4-trimethylpyridin-2-imine.
| Compound Name | methane;N,1,4-trimethylpyridin-2-imine |
|---|---|
| PubChem CID | 159097161 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | methane;N,1,4-trimethylpyridin-2-imine |
| SMILES | C.C/N=c1\cc(C)ccn1C |
| InChI | InChI=1S/C8H12N2.CH4/c1-7-4-5-10(3)8(6-7)9-2;/h4-6H,1-3H3;1H4/b9-8+; |
| InChIKey | KCUSVBPSETXRDH-HRNDJLQDSA-N |
| XLogP | 1.50 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |