C34H41F2N9O4 — CID 159099999
1-(2-fluoroethyl)-5-nitro-3-propylindazole;1-(2-fluoroethyl)-3-propylindazol-5-amine;5-nitro-3-propyl-2H-indazole (PubChem CID 159099999) has the molecular formula C34H41F2N9O4 and a molecular weight of 677.76 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-5-nitro-3-propylindazole;1-(2-fluoroethyl)-3-propylindazol-5-amine;5-nitro-3-propyl-2H-indazole.
| Compound Name | 1-(2-fluoroethyl)-5-nitro-3-propylindazole;1-(2-fluoroethyl)-3-propylindazol-5-amine;5-nitro-3-propyl-2H-indazole |
|---|---|
| PubChem CID | 159099999 |
| Molecular Formula | C34H41F2N9O4 |
| Molecular Weight | 677.76 g/mol |
| Exact Mass | 677.32 |
| IUPAC Name | 1-(2-fluoroethyl)-5-nitro-3-propylindazole;1-(2-fluoroethyl)-3-propylindazol-5-amine;5-nitro-3-propyl-2H-indazole |
| SMILES | CCCc1[nH]nc2ccc([N+](=O)[O-])cc12.CCCc1nn(CCF)c2ccc(N)cc12.CCCc1nn(CCF)c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C12H14FN3O2.C12H16FN3.C10H11N3O2/c1-2-3-11-10-8-9(16(17)18)4-5-12(10)15(14-11)7-6-13;1-2-3-11-10-8-9(14)4-5-12(10)16(15-11)7-6-13;1-2-3-9-8-6-7(13(14)15)4-5-10(8)12-11-9/h4-5,8H,2-3,6-7H2,1H3;4-5,8H,2-3,6-7,14H2,1H3;4-6H,2-3H2,1H3,(H,11,12) |
| InChIKey | KDDSLOQZOVQHIU-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 176.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.76 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|