C30H37ClN8O4 — CID 159105861
tert-butyl N-(6-chloro-5-methyl-3-pyridinyl)carbamate;tert-butyl N-(6-isocyano-5-methyl-3-pyridinyl)carbamate;6-isocyano-5-methylpyridin-3-amine (PubChem CID 159105861) has the molecular formula C30H37ClN8O4 and a molecular weight of 609.13 g/mol. Its IUPAC name is tert-butyl N-(6-chloro-5-methyl-3-pyridinyl)carbamate;tert-butyl N-(6-isocyano-5-methyl-3-pyridinyl)carbamate;6-isocyano-5-methylpyridin-3-amine.
| Compound Name | tert-butyl N-(6-chloro-5-methyl-3-pyridinyl)carbamate;tert-butyl N-(6-isocyano-5-methyl-3-pyridinyl)carbamate;6-isocyano-5-methylpyridin-3-amine |
|---|---|
| PubChem CID | 159105861 |
| Molecular Formula | C30H37ClN8O4 |
| Molecular Weight | 609.13 g/mol |
| Exact Mass | 608.26 |
| IUPAC Name | tert-butyl N-(6-chloro-5-methyl-3-pyridinyl)carbamate;tert-butyl N-(6-isocyano-5-methyl-3-pyridinyl)carbamate;6-isocyano-5-methylpyridin-3-amine |
| SMILES | Cc1cc(NC(=O)OC(C)(C)C)cnc1Cl.[C-]#[N+]c1ncc(N)cc1C.[C-]#[N+]c1ncc(NC(=O)OC(C)(C)C)cc1C |
| InChI | InChI=1S/C12H15N3O2.C11H15ClN2O2.C7H7N3/c1-8-6-9(7-14-10(8)13-5)15-11(16)17-12(2,3)4;1-7-5-8(6-13-9(7)12)14-10(15)16-11(2,3)4;1-5-3-6(8)4-10-7(5)9-2/h6-7H,1-4H3,(H,15,16);5-6H,1-4H3,(H,14,15);3-4H,8H2,1H3 |
| InChIKey | KDWJONAHSSQADG-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 150.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.13 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|