C26H33N3O4 — CID 159106807
9H-fluoren-9-ylmethyl N-[(3S,6R)-3-amino-6-carbamoyl-8-methyl-4-oxononyl]carbamate (PubChem CID 159106807) has the molecular formula C26H33N3O4 and a molecular weight of 451.57 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(3S,6R)-3-amino-6-carbamoyl-8-methyl-4-oxononyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(3S,6R)-3-amino-6-carbamoyl-8-methyl-4-oxononyl]carbamate |
|---|---|
| PubChem CID | 159106807 |
| Molecular Formula | C26H33N3O4 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(3S,6R)-3-amino-6-carbamoyl-8-methyl-4-oxononyl]carbamate |
| SMILES | CC(C)C[C@H](CC(=O)[C@@H](N)CCNC(=O)OCC1c2ccccc2-c2ccccc21)C(N)=O |
| InChI | InChI=1S/C26H33N3O4/c1-16(2)13-17(25(28)31)14-24(30)23(27)11-12-29-26(32)33-15-22-20-9-5-3-7-18(20)19-8-4-6-10-21(19)22/h3-10,16-17,22-23H,11-15,27H2,1-2H3,(H2,28,31)(H,29,32)/t17-,23+/m1/s1 |
| InChIKey | LIASKFURORJGJP-HXOBKFHXSA-N |
| XLogP | 3.35 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |