C23H26N2O4 — CID 159109154
(E)-but-2-enedioic acid;4-(4-phenylphenyl)-1,4-diazabicyclo[3.2.2]nonane (PubChem CID 159109154) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;4-(4-phenylphenyl)-1,4-diazabicyclo[3.2.2]nonane.
| Compound Name | (E)-but-2-enedioic acid;4-(4-phenylphenyl)-1,4-diazabicyclo[3.2.2]nonane |
|---|---|
| PubChem CID | 159109154 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | (E)-but-2-enedioic acid;4-(4-phenylphenyl)-1,4-diazabicyclo[3.2.2]nonane |
| SMILES | O=C(O)/C=C/C(=O)O.c1ccc(-c2ccc(N3CCN4CCC3CC4)cc2)cc1 |
| InChI | InChI=1S/C19H22N2.C4H4O4/c1-2-4-16(5-3-1)17-6-8-18(9-7-17)21-15-14-20-12-10-19(21)11-13-20;5-3(6)1-2-4(7)8/h1-9,19H,10-15H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | KEGNDYMZKSTWCJ-WLHGVMLRSA-N |
| XLogP | 3.35 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|