C22H28N2O4 — CID 6445884
(E)-but-2-enedioic acid;1-prop-2-ynyl-4-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)piperazine (PubChem CID 6445884) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1-prop-2-ynyl-4-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)piperazine.
| Compound Name | (E)-but-2-enedioic acid;1-prop-2-ynyl-4-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)piperazine |
|---|---|
| PubChem CID | 6445884 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | (E)-but-2-enedioic acid;1-prop-2-ynyl-4-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)piperazine |
| SMILES | C#CCN1CCN(c2ccc3c(c2)CCCCC3)CC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C18H24N2.C4H4O4/c1-2-10-19-11-13-20(14-12-19)18-9-8-16-6-4-3-5-7-17(16)15-18;5-3(6)1-2-4(7)8/h1,8-9,15H,3-7,10-14H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | ZJNCQTOMEAKIHI-WLHGVMLRSA-N |
| XLogP | 2.42 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|