C28H36N2O4 — CID 6445885
(E)-but-2-enedioic acid;1-(3-phenylpropyl)-4-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)piperazine (PubChem CID 6445885) has the molecular formula C28H36N2O4 and a molecular weight of 464.61 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1-(3-phenylpropyl)-4-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)piperazine.
| Compound Name | (E)-but-2-enedioic acid;1-(3-phenylpropyl)-4-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)piperazine |
|---|---|
| PubChem CID | 6445885 |
| Molecular Formula | C28H36N2O4 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | (E)-but-2-enedioic acid;1-(3-phenylpropyl)-4-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)piperazine |
| SMILES | O=C(O)/C=C/C(=O)O.c1ccc(CCCN2CCN(c3ccc4c(c3)CCCCC4)CC2)cc1 |
| InChI | InChI=1S/C24H32N2.C4H4O4/c1-3-8-21(9-4-1)10-7-15-25-16-18-26(19-17-25)24-14-13-22-11-5-2-6-12-23(22)20-24;5-3(6)1-2-4(7)8/h1,3-4,8-9,13-14,20H,2,5-7,10-12,15-19H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | PKVYMUSJDDTURY-WLHGVMLRSA-N |
| XLogP | 4.42 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|