C11H14F6NO4P — CID 159116546
2-ethyl-3,4-bis(2,2,2-trifluoroethyl)pyridine;phosphoric acid (PubChem CID 159116546) has the molecular formula C11H14F6NO4P and a molecular weight of 369.20 g/mol. Its IUPAC name is 2-ethyl-3,4-bis(2,2,2-trifluoroethyl)pyridine;phosphoric acid.
| Compound Name | 2-ethyl-3,4-bis(2,2,2-trifluoroethyl)pyridine;phosphoric acid |
|---|---|
| PubChem CID | 159116546 |
| Molecular Formula | C11H14F6NO4P |
| Molecular Weight | 369.20 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 2-ethyl-3,4-bis(2,2,2-trifluoroethyl)pyridine;phosphoric acid |
| SMILES | CCc1nccc(CC(F)(F)F)c1CC(F)(F)F.O=P(O)(O)O |
| InChI | InChI=1S/C11H11F6N.H3O4P/c1-2-9-8(6-11(15,16)17)7(3-4-18-9)5-10(12,13)14;1-5(2,3)4/h3-4H,2,5-6H2,1H3;(H3,1,2,3,4) |
| InChIKey | YHDYZOQKEIWNEA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.20 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|