C10H14ClN — CID 168797457
3-(chloromethyl)-2,4-diethylpyridine (PubChem CID 168797457) has the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. Its IUPAC name is 3-(chloromethyl)-2,4-diethylpyridine.
| Compound Name | 3-(chloromethyl)-2,4-diethylpyridine |
|---|---|
| PubChem CID | 168797457 |
| Molecular Formula | C10H14ClN |
| Molecular Weight | 183.68 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 3-(chloromethyl)-2,4-diethylpyridine |
| SMILES | CCc1ccnc(CC)c1CCl |
| InChI | InChI=1S/C10H14ClN/c1-3-8-5-6-12-10(4-2)9(8)7-11/h5-6H,3-4,7H2,1-2H3 |
| InChIKey | RFYOCHQUYGPRPE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.68 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|