C18H27NO4 — CID 159130576
(4R)-4-[4-[(4S)-4-(2-methoxyethoxy)pyrrolidin-3-yl]oxyphenyl]pentan-2-one (PubChem CID 159130576) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is (4R)-4-[4-[(4S)-4-(2-methoxyethoxy)pyrrolidin-3-yl]oxyphenyl]pentan-2-one.
| Compound Name | (4R)-4-[4-[(4S)-4-(2-methoxyethoxy)pyrrolidin-3-yl]oxyphenyl]pentan-2-one |
|---|---|
| PubChem CID | 159130576 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | (4R)-4-[4-[(4S)-4-(2-methoxyethoxy)pyrrolidin-3-yl]oxyphenyl]pentan-2-one |
| SMILES | COCCO[C@H]1CNCC1Oc1ccc([C@H](C)CC(C)=O)cc1 |
| InChI | InChI=1S/C18H27NO4/c1-13(10-14(2)20)15-4-6-16(7-5-15)23-18-12-19-11-17(18)22-9-8-21-3/h4-7,13,17-19H,8-12H2,1-3H3/t13-,17+,18?/m1/s1 |
| InChIKey | KGVLECZAJSQWQU-GTDUKUAFSA-N |
| XLogP | 2.15 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|