C32H54N6O8 — CID 159134914
tert-butyl 4-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)piperidine-1-carboxylate;1-O-tert-butyl 4-O-ethyl piperidine-1,4-dicarboxylate;N'-hydroxycyclopropanecarboximidamide (PubChem CID 159134914) has the molecular formula C32H54N6O8 and a molecular weight of 650.82 g/mol. Its IUPAC name is tert-butyl 4-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)piperidine-1-carboxylate;1-O-tert-butyl 4-O-ethyl piperidine-1,4-dicarboxylate;N'-hydroxycyclopropanecarboximidamide.
| Compound Name | tert-butyl 4-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)piperidine-1-carboxylate;1-O-tert-butyl 4-O-ethyl piperidine-1,4-dicarboxylate;N'-hydroxycyclopropanecarboximidamide |
|---|---|
| PubChem CID | 159134914 |
| Molecular Formula | C32H54N6O8 |
| Molecular Weight | 650.82 g/mol |
| Exact Mass | 650.40 |
| IUPAC Name | tert-butyl 4-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)piperidine-1-carboxylate;1-O-tert-butyl 4-O-ethyl piperidine-1,4-dicarboxylate;N'-hydroxycyclopropanecarboximidamide |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2nc(C3CC3)no2)CC1.CCOC(=O)C1CCN(C(=O)OC(C)(C)C)CC1.NC(=NO)C1CC1 |
| InChI | InChI=1S/C15H23N3O3.C13H23NO4.C4H8N2O/c1-15(2,3)20-14(19)18-8-6-11(7-9-18)13-16-12(17-21-13)10-4-5-10;1-5-17-11(15)10-6-8-14(9-7-10)12(16)18-13(2,3)4;5-4(6-7)3-1-2-3/h10-11H,4-9H2,1-3H3;10H,5-9H2,1-4H3;3,7H,1-2H2,(H2,5,6) |
| InChIKey | KHJFIHYJDAKNCG-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 182.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.82 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|