C25H28ClN3O12S2 — CID 159137370
4-(chloromethyl)-2-methyl-1-nitrobenzene;(2-methyl-4-nitrophenyl)methyl methanesulfonate;(4-nitrophenyl)methyl methanesulfonate (PubChem CID 159137370) has the molecular formula C25H28ClN3O12S2 and a molecular weight of 662.10 g/mol. Its IUPAC name is 4-(chloromethyl)-2-methyl-1-nitrobenzene;(2-methyl-4-nitrophenyl)methyl methanesulfonate;(4-nitrophenyl)methyl methanesulfonate.
| Compound Name | 4-(chloromethyl)-2-methyl-1-nitrobenzene;(2-methyl-4-nitrophenyl)methyl methanesulfonate;(4-nitrophenyl)methyl methanesulfonate |
|---|---|
| PubChem CID | 159137370 |
| Molecular Formula | C25H28ClN3O12S2 |
| Molecular Weight | 662.10 g/mol |
| Exact Mass | 661.08 |
| IUPAC Name | 4-(chloromethyl)-2-methyl-1-nitrobenzene;(2-methyl-4-nitrophenyl)methyl methanesulfonate;(4-nitrophenyl)methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCc1ccc([N+](=O)[O-])cc1.Cc1cc(CCl)ccc1[N+](=O)[O-].Cc1cc([N+](=O)[O-])ccc1COS(C)(=O)=O |
| InChI | InChI=1S/C9H11NO5S.C8H8ClNO2.C8H9NO5S/c1-7-5-9(10(11)12)4-3-8(7)6-15-16(2,13)14;1-6-4-7(5-9)2-3-8(6)10(11)12;1-15(12,13)14-6-7-2-4-8(5-3-7)9(10)11/h3-5H,6H2,1-2H3;2-4H,5H2,1H3;2-5H,6H2,1H3 |
| InChIKey | KHQXXEFLEQGLID-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 216.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.10 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|