C26H23BrN2O3S — CID 159138263
4-[2-bromo-5-[2-(4-piperidin-1-ylsulfonylphenyl)acetyl]phenyl]benzonitrile (PubChem CID 159138263) has the molecular formula C26H23BrN2O3S and a molecular weight of 523.45 g/mol. Its IUPAC name is 4-[2-bromo-5-[2-(4-piperidin-1-ylsulfonylphenyl)acetyl]phenyl]benzonitrile.
| Compound Name | 4-[2-bromo-5-[2-(4-piperidin-1-ylsulfonylphenyl)acetyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 159138263 |
| Molecular Formula | C26H23BrN2O3S |
| Molecular Weight | 523.45 g/mol |
| Exact Mass | 522.06 |
| IUPAC Name | 4-[2-bromo-5-[2-(4-piperidin-1-ylsulfonylphenyl)acetyl]phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2cc(C(=O)Cc3ccc(S(=O)(=O)N4CCCCC4)cc3)ccc2Br)cc1 |
| InChI | InChI=1S/C26H23BrN2O3S/c27-25-13-10-22(17-24(25)21-8-4-20(18-28)5-9-21)26(30)16-19-6-11-23(12-7-19)33(31,32)29-14-2-1-3-15-29/h4-13,17H,1-3,14-16H2 |
| InChIKey | KHTRZUNPRWYLRV-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 78.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.45 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |