About 5-bromo-2-fluoropyridine;2-fluoro-5-phenylpyridine;phenylboronic acid
5-bromo-2-fluoropyridine;2-fluoro-5-phenylpyridine;phenylboronic acid (PubChem CID 159152393) has the molecular formula C22H18BBrF2N2O2
and a molecular weight of 471.11 g/mol. Its IUPAC name is 5-bromo-2-fluoropyridine;2-fluoro-5-phenylpyridine;phenylboronic acid.
Molecular Properties
| Compound Name | 5-bromo-2-fluoropyridine;2-fluoro-5-phenylpyridine;phenylboronic acid |
| PubChem CID | 159152393 |
| Molecular Formula | C22H18BBrF2N2O2 |
| Molecular Weight | 471.11 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | 5-bromo-2-fluoropyridine;2-fluoro-5-phenylpyridine;phenylboronic acid |
| SMILES | Fc1ccc(-c2ccccc2)cn1.Fc1ccc(Br)cn1.OB(O)c1ccccc1 |
| InChI | InChI=1S/C11H8FN.C6H7BO2.C5H3BrFN/c12-11-7-6-10(8-13-11)9-4-2-1-3-5-9;8-7(9)6-4-2-1-3-5-6;6-4-1-2-5(7)8-3-4/h1-8H;1-5,8-9H;1-3H |
| InChIKey | KJLUZRMWUPIXOK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.11 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-fluoropyridine;2-fluoro-5-phenylpyridine;phenylboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-fluoropyridine;2-fluoro-5-phenylpyridine;phenylboronic acid?
The IUPAC name of 5-bromo-2-fluoropyridine;2-fluoro-5-phenylpyridine;phenylboronic acid (CID 159152393) is 5-bromo-2-fluoropyridine;2-fluoro-5-phenylpyridine;phenylboronic acid.
What is the SMILES notation for 5-bromo-2-fluoropyridine;2-fluoro-5-phenylpyridine;phenylboronic acid?
The canonical SMILES for 5-bromo-2-fluoropyridine;2-fluoro-5-phenylpyridine;phenylboronic acid is Fc1ccc(-c2ccccc2)cn1.Fc1ccc(Br)cn1.OB(O)c1ccccc1.
What is the InChIKey of 5-bromo-2-fluoropyridine;2-fluoro-5-phenylpyridine;phenylboronic acid?
The InChIKey is KJLUZRMWUPIXOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8FN.C6H7BO2.C5H3BrFN/c12-11-7-6-10(8-13-11)9-4-2-1-3-5-9;8-7(9)6-4-2-1-3-5-6;6-4-1-2-5(7)8-3-4/h1-8H;1-5,8-9H;1-3H.
What are the key properties of 5-bromo-2-fluoropyridine;2-fluoro-5-phenylpyridine;phenylboronic acid?
5-bromo-2-fluoropyridine;2-fluoro-5-phenylpyridine;phenylboronic acid has a molecular weight of 471.11 g/mol, XLogP of 4.24, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-fluoropyridine;2-fluoro-5-phenylpyridine;phenylboronic acid is sourced from PubChem (CID 159152393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).