C25H34Cl2N4O6 — CID 159152951
4-(5-amino-2-chloro-4-pyridinyl)oxan-4-ol;tert-butyl N-[6-chloro-4-(4-hydroxyoxan-4-yl)-3-pyridinyl]carbamate (PubChem CID 159152951) has the molecular formula C25H34Cl2N4O6 and a molecular weight of 557.48 g/mol. Its IUPAC name is 4-(5-amino-2-chloro-4-pyridinyl)oxan-4-ol;tert-butyl N-[6-chloro-4-(4-hydroxyoxan-4-yl)-3-pyridinyl]carbamate.
| Compound Name | 4-(5-amino-2-chloro-4-pyridinyl)oxan-4-ol;tert-butyl N-[6-chloro-4-(4-hydroxyoxan-4-yl)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 159152951 |
| Molecular Formula | C25H34Cl2N4O6 |
| Molecular Weight | 557.48 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | 4-(5-amino-2-chloro-4-pyridinyl)oxan-4-ol;tert-butyl N-[6-chloro-4-(4-hydroxyoxan-4-yl)-3-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cnc(Cl)cc1C1(O)CCOCC1.Nc1cnc(Cl)cc1C1(O)CCOCC1 |
| InChI | InChI=1S/C15H21ClN2O4.C10H13ClN2O2/c1-14(2,3)22-13(19)18-11-9-17-12(16)8-10(11)15(20)4-6-21-7-5-15;11-9-5-7(8(12)6-13-9)10(14)1-3-15-4-2-10/h8-9,20H,4-7H2,1-3H3,(H,18,19);5-6,14H,1-4,12H2 |
| InChIKey | KJNNMKYVBBJBPJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 149.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|