C10H11BClIN2O2 — CID 89120768
CID 89120768 (PubChem CID 89120768) has the molecular formula C10H11BClIN2O2 and a molecular weight of 364.38 g/mol.
| Compound Name | CID 89120768 |
|---|---|
| PubChem CID | 89120768 |
| Molecular Formula | C10H11BClIN2O2 |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 363.96 |
| IUPAC Name | — |
| SMILES | [B]c1c(Cl)ncc(NC(=O)OC(C)(C)C)c1I |
| InChI | InChI=1S/C10H11BClIN2O2/c1-10(2,3)17-9(16)15-5-4-14-8(12)6(11)7(5)13/h4H,1-3H3,(H,15,16) |
| InChIKey | JYJATKWBNVJRKS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|