C10H12IN2O4S- — CID 70940194
4-iodo-5-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-2-sulfinate (PubChem CID 70940194) has the molecular formula C10H12IN2O4S- and a molecular weight of 383.19 g/mol. Its IUPAC name is 4-iodo-5-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-2-sulfinate.
| Compound Name | 4-iodo-5-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-2-sulfinate |
|---|---|
| PubChem CID | 70940194 |
| Molecular Formula | C10H12IN2O4S- |
| Molecular Weight | 383.19 g/mol |
| Exact Mass | 382.96 |
| IUPAC Name | 4-iodo-5-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-2-sulfinate |
| SMILES | CC(C)(C)OC(=O)Nc1cnc(S(=O)[O-])cc1I |
| InChI | InChI=1S/C10H13IN2O4S/c1-10(2,3)17-9(14)13-7-5-12-8(18(15)16)4-6(7)11/h4-5H,1-3H3,(H,13,14)(H,15,16)/p-1 |
| InChIKey | KLLVGDKLMNLSQS-UHFFFAOYSA-M |
| XLogP | 2.27 |
| TPSA | 91.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.19 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|