About 2-(4-bromo-2-pyridinyl)-1-(4-methoxyphenyl)ethanone;methyl 4-methoxybenzoate
2-(4-bromo-2-pyridinyl)-1-(4-methoxyphenyl)ethanone;methyl 4-methoxybenzoate (PubChem CID 159153418) has the molecular formula C23H22BrNO5
and a molecular weight of 472.34 g/mol. Its IUPAC name is 2-(4-bromo-2-pyridinyl)-1-(4-methoxyphenyl)ethanone;methyl 4-methoxybenzoate.
Molecular Properties
| Compound Name | 2-(4-bromo-2-pyridinyl)-1-(4-methoxyphenyl)ethanone;methyl 4-methoxybenzoate |
| PubChem CID | 159153418 |
| Molecular Formula | C23H22BrNO5 |
| Molecular Weight | 472.34 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | 2-(4-bromo-2-pyridinyl)-1-(4-methoxyphenyl)ethanone;methyl 4-methoxybenzoate |
| SMILES | COC(=O)c1ccc(OC)cc1.COc1ccc(C(=O)Cc2cc(Br)ccn2)cc1 |
| InChI | InChI=1S/C14H12BrNO2.C9H10O3/c1-18-13-4-2-10(3-5-13)14(17)9-12-8-11(15)6-7-16-12;1-11-8-5-3-7(4-6-8)9(10)12-2/h2-8H,9H2,1H3;3-6H,1-2H3 |
| InChIKey | KJPAJMVUBJQKSW-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 472.34 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4-bromo-2-pyridinyl)-1-(4-methoxyphenyl)ethanone;methyl 4-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromo-2-pyridinyl)-1-(4-methoxyphenyl)ethanone;methyl 4-methoxybenzoate?
The IUPAC name of 2-(4-bromo-2-pyridinyl)-1-(4-methoxyphenyl)ethanone;methyl 4-methoxybenzoate (CID 159153418) is 2-(4-bromo-2-pyridinyl)-1-(4-methoxyphenyl)ethanone;methyl 4-methoxybenzoate.
What is the SMILES notation for 2-(4-bromo-2-pyridinyl)-1-(4-methoxyphenyl)ethanone;methyl 4-methoxybenzoate?
The canonical SMILES for 2-(4-bromo-2-pyridinyl)-1-(4-methoxyphenyl)ethanone;methyl 4-methoxybenzoate is COC(=O)c1ccc(OC)cc1.COc1ccc(C(=O)Cc2cc(Br)ccn2)cc1.
What is the InChIKey of 2-(4-bromo-2-pyridinyl)-1-(4-methoxyphenyl)ethanone;methyl 4-methoxybenzoate?
The InChIKey is KJPAJMVUBJQKSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12BrNO2.C9H10O3/c1-18-13-4-2-10(3-5-13)14(17)9-12-8-11(15)6-7-16-12;1-11-8-5-3-7(4-6-8)9(10)12-2/h2-8H,9H2,1H3;3-6H,1-2H3.
What are the key properties of 2-(4-bromo-2-pyridinyl)-1-(4-methoxyphenyl)ethanone;methyl 4-methoxybenzoate?
2-(4-bromo-2-pyridinyl)-1-(4-methoxyphenyl)ethanone;methyl 4-methoxybenzoate has a molecular weight of 472.34 g/mol, XLogP of 4.76, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromo-2-pyridinyl)-1-(4-methoxyphenyl)ethanone;methyl 4-methoxybenzoate is sourced from PubChem (CID 159153418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).