C17H17FN4O4S — CID 159158591
[1-(7-fluoro-6-isocyanoquinazolin-4-yl)-3-(methylsulfonylmethyl)piperidin-4-yl] formate (PubChem CID 159158591) has the molecular formula C17H17FN4O4S and a molecular weight of 392.41 g/mol. Its IUPAC name is [1-(7-fluoro-6-isocyanoquinazolin-4-yl)-3-(methylsulfonylmethyl)piperidin-4-yl] formate.
| Compound Name | [1-(7-fluoro-6-isocyanoquinazolin-4-yl)-3-(methylsulfonylmethyl)piperidin-4-yl] formate |
|---|---|
| PubChem CID | 159158591 |
| Molecular Formula | C17H17FN4O4S |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | [1-(7-fluoro-6-isocyanoquinazolin-4-yl)-3-(methylsulfonylmethyl)piperidin-4-yl] formate |
| SMILES | [C-]#[N+]c1cc2c(N3CCC(OC=O)C(CS(C)(=O)=O)C3)ncnc2cc1F |
| InChI | InChI=1S/C17H17FN4O4S/c1-19-15-5-12-14(6-13(15)18)20-9-21-17(12)22-4-3-16(26-10-23)11(7-22)8-27(2,24)25/h5-6,9-11,16H,3-4,7-8H2,2H3 |
| InChIKey | CLLKNSUJVFKOTQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 93.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|