About acetyl chloride;tert-butyl 4-acetyloxy-3-(1-acetyloxypent-4-ynyl)piperidine-1-carboxylate
acetyl chloride;tert-butyl 4-acetyloxy-3-(1-acetyloxypent-4-ynyl)piperidine-1-carboxylate (PubChem CID 159160322) has the molecular formula C21H32ClNO7
and a molecular weight of 445.94 g/mol. Its IUPAC name is acetyl chloride;tert-butyl 4-acetyloxy-3-(1-acetyloxypent-4-ynyl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | acetyl chloride;tert-butyl 4-acetyloxy-3-(1-acetyloxypent-4-ynyl)piperidine-1-carboxylate |
| PubChem CID | 159160322 |
| Molecular Formula | C21H32ClNO7 |
| Molecular Weight | 445.94 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | acetyl chloride;tert-butyl 4-acetyloxy-3-(1-acetyloxypent-4-ynyl)piperidine-1-carboxylate |
| SMILES | C#CCCC(OC(C)=O)C1CN(C(=O)OC(C)(C)C)CCC1OC(C)=O.CC(=O)Cl |
| InChI | InChI=1S/C19H29NO6.C2H3ClO/c1-7-8-9-16(24-13(2)21)15-12-20(18(23)26-19(4,5)6)11-10-17(15)25-14(3)22;1-2(3)4/h1,15-17H,8-12H2,2-6H3;1H3 |
| InChIKey | KKKFATFYWSEICD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.94 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetyl chloride;tert-butyl 4-acetyloxy-3-(1-acetyloxypent-4-ynyl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl chloride;tert-butyl 4-acetyloxy-3-(1-acetyloxypent-4-ynyl)piperidine-1-carboxylate?
The IUPAC name of acetyl chloride;tert-butyl 4-acetyloxy-3-(1-acetyloxypent-4-ynyl)piperidine-1-carboxylate (CID 159160322) is acetyl chloride;tert-butyl 4-acetyloxy-3-(1-acetyloxypent-4-ynyl)piperidine-1-carboxylate.
What is the SMILES notation for acetyl chloride;tert-butyl 4-acetyloxy-3-(1-acetyloxypent-4-ynyl)piperidine-1-carboxylate?
The canonical SMILES for acetyl chloride;tert-butyl 4-acetyloxy-3-(1-acetyloxypent-4-ynyl)piperidine-1-carboxylate is C#CCCC(OC(C)=O)C1CN(C(=O)OC(C)(C)C)CCC1OC(C)=O.CC(=O)Cl.
What is the InChIKey of acetyl chloride;tert-butyl 4-acetyloxy-3-(1-acetyloxypent-4-ynyl)piperidine-1-carboxylate?
The InChIKey is KKKFATFYWSEICD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29NO6.C2H3ClO/c1-7-8-9-16(24-13(2)21)15-12-20(18(23)26-19(4,5)6)11-10-17(15)25-14(3)22;1-2(3)4/h1,15-17H,8-12H2,2-6H3;1H3.
What are the key properties of acetyl chloride;tert-butyl 4-acetyloxy-3-(1-acetyloxypent-4-ynyl)piperidine-1-carboxylate?
acetyl chloride;tert-butyl 4-acetyloxy-3-(1-acetyloxypent-4-ynyl)piperidine-1-carboxylate has a molecular weight of 445.94 g/mol, XLogP of 3.29, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl chloride;tert-butyl 4-acetyloxy-3-(1-acetyloxypent-4-ynyl)piperidine-1-carboxylate is sourced from PubChem (CID 159160322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).