About tert-butyl 4-acetyloxy-3-[5-(methoxymethoxy)pentan-2-yl]piperidine-1-carboxylate
tert-butyl 4-acetyloxy-3-[5-(methoxymethoxy)pentan-2-yl]piperidine-1-carboxylate (PubChem CID 70008509) has the molecular formula C19H35NO6
and a molecular weight of 373.49 g/mol. Its IUPAC name is tert-butyl 4-acetyloxy-3-[5-(methoxymethoxy)pentan-2-yl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-acetyloxy-3-[5-(methoxymethoxy)pentan-2-yl]piperidine-1-carboxylate |
| PubChem CID | 70008509 |
| Molecular Formula | C19H35NO6 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | tert-butyl 4-acetyloxy-3-[5-(methoxymethoxy)pentan-2-yl]piperidine-1-carboxylate |
| SMILES | COCOCCCC(C)C1CN(C(=O)OC(C)(C)C)CCC1OC(C)=O |
| InChI | InChI=1S/C19H35NO6/c1-14(8-7-11-24-13-23-6)16-12-20(18(22)26-19(3,4)5)10-9-17(16)25-15(2)21/h14,16-17H,7-13H2,1-6H3 |
| InChIKey | UZZKJLYWKIUTSW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-acetyloxy-3-[5-(methoxymethoxy)pentan-2-yl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-acetyloxy-3-[5-(methoxymethoxy)pentan-2-yl]piperidine-1-carboxylate?
The IUPAC name of tert-butyl 4-acetyloxy-3-[5-(methoxymethoxy)pentan-2-yl]piperidine-1-carboxylate (CID 70008509) is tert-butyl 4-acetyloxy-3-[5-(methoxymethoxy)pentan-2-yl]piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-acetyloxy-3-[5-(methoxymethoxy)pentan-2-yl]piperidine-1-carboxylate?
The canonical SMILES for tert-butyl 4-acetyloxy-3-[5-(methoxymethoxy)pentan-2-yl]piperidine-1-carboxylate is COCOCCCC(C)C1CN(C(=O)OC(C)(C)C)CCC1OC(C)=O.
What is the InChIKey of tert-butyl 4-acetyloxy-3-[5-(methoxymethoxy)pentan-2-yl]piperidine-1-carboxylate?
The InChIKey is UZZKJLYWKIUTSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H35NO6/c1-14(8-7-11-24-13-23-6)16-12-20(18(22)26-19(3,4)5)10-9-17(16)25-15(2)21/h14,16-17H,7-13H2,1-6H3.
What are the key properties of tert-butyl 4-acetyloxy-3-[5-(methoxymethoxy)pentan-2-yl]piperidine-1-carboxylate?
tert-butyl 4-acetyloxy-3-[5-(methoxymethoxy)pentan-2-yl]piperidine-1-carboxylate has a molecular weight of 373.49 g/mol, XLogP of 3.21, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-acetyloxy-3-[5-(methoxymethoxy)pentan-2-yl]piperidine-1-carboxylate is sourced from PubChem (CID 70008509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).