C28H26N6O6 — CID 159160853
1-(4-aminophenyl)-3-(3-nitrophenyl)propan-2-one;benzene-1,4-diamine;(3-nitrophenyl) cyanate (PubChem CID 159160853) has the molecular formula C28H26N6O6 and a molecular weight of 542.55 g/mol. Its IUPAC name is 1-(4-aminophenyl)-3-(3-nitrophenyl)propan-2-one;benzene-1,4-diamine;(3-nitrophenyl) cyanate.
| Compound Name | 1-(4-aminophenyl)-3-(3-nitrophenyl)propan-2-one;benzene-1,4-diamine;(3-nitrophenyl) cyanate |
|---|---|
| PubChem CID | 159160853 |
| Molecular Formula | C28H26N6O6 |
| Molecular Weight | 542.55 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | 1-(4-aminophenyl)-3-(3-nitrophenyl)propan-2-one;benzene-1,4-diamine;(3-nitrophenyl) cyanate |
| SMILES | N#COc1cccc([N+](=O)[O-])c1.Nc1ccc(CC(=O)Cc2cccc([N+](=O)[O-])c2)cc1.Nc1ccc(N)cc1 |
| InChI | InChI=1S/C15H14N2O3.C7H4N2O3.C6H8N2/c16-13-6-4-11(5-7-13)9-15(18)10-12-2-1-3-14(8-12)17(19)20;8-5-12-7-3-1-2-6(4-7)9(10)11;7-5-1-2-6(8)4-3-5/h1-8H,9-10,16H2;1-4H;1-4H,7-8H2 |
| InChIKey | KKLQPXQNUKYWTD-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 214.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.55 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|